C18H24F3NO2 — CID 102314864
(7R)-7-methyl-7-(4-methylpent-3-enyl)-1-(2,2,2-trifluoroacetyl)-3,4,6,8-tetrahydro-2H-quinolin-5-one (PubChem CID 102314864) has the molecular formula C18H24F3NO2 and a molecular weight of 343.39 g/mol. Its IUPAC name is (7R)-7-methyl-7-(4-methylpent-3-enyl)-1-(2,2,2-trifluoroacetyl)-3,4,6,8-tetrahydro-2H-quinolin-5-one.
| Compound Name | (7R)-7-methyl-7-(4-methylpent-3-enyl)-1-(2,2,2-trifluoroacetyl)-3,4,6,8-tetrahydro-2H-quinolin-5-one |
|---|---|
| PubChem CID | 102314864 |
| Molecular Formula | C18H24F3NO2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | (7R)-7-methyl-7-(4-methylpent-3-enyl)-1-(2,2,2-trifluoroacetyl)-3,4,6,8-tetrahydro-2H-quinolin-5-one |
| SMILES | CC(C)=CCC[C@@]1(C)CC(=O)C2=C(C1)N(C(=O)C(F)(F)F)CCC2 |
| InChI | InChI=1S/C18H24F3NO2/c1-12(2)6-4-8-17(3)10-14-13(15(23)11-17)7-5-9-22(14)16(24)18(19,20)21/h6H,4-5,7-11H2,1-3H3/t17-/m1/s1 |
| InChIKey | KOYGFXUZQCPFKK-QGZVFWFLSA-N |
| XLogP | 4.54 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|