C38H38BrN3O — CID 102315201
4-(5-bromo-2,7-ditert-butyl-9,9-dimethylxanthen-4-yl)-2,6-dipyridin-2-ylpyridine (PubChem CID 102315201) has the molecular formula C38H38BrN3O and a molecular weight of 632.65 g/mol. Its IUPAC name is 4-(5-bromo-2,7-ditert-butyl-9,9-dimethylxanthen-4-yl)-2,6-dipyridin-2-ylpyridine.
| Compound Name | 4-(5-bromo-2,7-ditert-butyl-9,9-dimethylxanthen-4-yl)-2,6-dipyridin-2-ylpyridine |
|---|---|
| PubChem CID | 102315201 |
| Molecular Formula | C38H38BrN3O |
| Molecular Weight | 632.65 g/mol |
| Exact Mass | 631.22 |
| IUPAC Name | 4-(5-bromo-2,7-ditert-butyl-9,9-dimethylxanthen-4-yl)-2,6-dipyridin-2-ylpyridine |
| SMILES | CC(C)(C)c1cc(Br)c2c(c1)C(C)(C)c1cc(C(C)(C)C)cc(-c3cc(-c4ccccn4)nc(-c4ccccn4)c3)c1O2 |
| InChI | InChI=1S/C38H38BrN3O/c1-36(2,3)24-19-26(23-17-32(30-13-9-11-15-40-30)42-33(18-23)31-14-10-12-16-41-31)34-27(20-24)38(7,8)28-21-25(37(4,5)6)22-29(39)35(28)43-34/h9-22H,1-8H3 |
| InChIKey | YWDLRHIVHDCBKJ-UHFFFAOYSA-N |
| XLogP | 10.66 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.65 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |