C24H24O6S — CID 102315220
[(2R,3R,4S)-2,4-dimethoxy-3-phenyl-3,4-dihydro-2H-chromen-7-yl] 4-methylbenzenesulfonate (PubChem CID 102315220) has the molecular formula C24H24O6S and a molecular weight of 440.52 g/mol. Its IUPAC name is [(2R,3R,4S)-2,4-dimethoxy-3-phenyl-3,4-dihydro-2H-chromen-7-yl] 4-methylbenzenesulfonate.
| Compound Name | [(2R,3R,4S)-2,4-dimethoxy-3-phenyl-3,4-dihydro-2H-chromen-7-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 102315220 |
| Molecular Formula | C24H24O6S |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | [(2R,3R,4S)-2,4-dimethoxy-3-phenyl-3,4-dihydro-2H-chromen-7-yl] 4-methylbenzenesulfonate |
| SMILES | CO[C@@H]1Oc2cc(OS(=O)(=O)c3ccc(C)cc3)ccc2[C@@H](OC)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C24H24O6S/c1-16-9-12-19(13-10-16)31(25,26)30-18-11-14-20-21(15-18)29-24(28-3)22(23(20)27-2)17-7-5-4-6-8-17/h4-15,22-24H,1-3H3/t22-,23-,24-/m1/s1 |
| InChIKey | YWAMIFHBCODTQK-WXFUMESZSA-N |
| XLogP | 4.60 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|