C29H19F4NO7 — CID 10231585
4'-[(4-acetylphenyl)carbamoyl]-5'-[3-fluoro-4-(trifluoromethyl)phenyl]-1,3-dioxospiro[indene-2,2'-oxolane]-3'-carboxylic acid (PubChem CID 10231585) has the molecular formula C29H19F4NO7 and a molecular weight of 569.46 g/mol. Its IUPAC name is 4'-[(4-acetylphenyl)carbamoyl]-5'-[3-fluoro-4-(trifluoromethyl)phenyl]-1,3-dioxospiro[indene-2,2'-oxolane]-3'-carboxylic acid.
| Compound Name | 4'-[(4-acetylphenyl)carbamoyl]-5'-[3-fluoro-4-(trifluoromethyl)phenyl]-1,3-dioxospiro[indene-2,2'-oxolane]-3'-carboxylic acid |
|---|---|
| PubChem CID | 10231585 |
| Molecular Formula | C29H19F4NO7 |
| Molecular Weight | 569.46 g/mol |
| Exact Mass | 569.11 |
| IUPAC Name | 4'-[(4-acetylphenyl)carbamoyl]-5'-[3-fluoro-4-(trifluoromethyl)phenyl]-1,3-dioxospiro[indene-2,2'-oxolane]-3'-carboxylic acid |
| SMILES | CC(=O)c1ccc(NC(=O)C2C(c3ccc(C(F)(F)F)c(F)c3)OC3(C(=O)c4ccccc4C3=O)C2C(=O)O)cc1 |
| InChI | InChI=1S/C29H19F4NO7/c1-13(35)14-6-9-16(10-7-14)34-26(38)21-22(27(39)40)28(24(36)17-4-2-3-5-18(17)25(28)37)41-23(21)15-8-11-19(20(30)12-15)29(31,32)33/h2-12,21-23H,1H3,(H,34,38)(H,39,40) |
| InChIKey | VYQHIJBEPPMSLQ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 126.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.46 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|