About 4-[(Z)-2,3,3,3-tetrafluoroprop-1-enyl]morpholine
4-[(Z)-2,3,3,3-tetrafluoroprop-1-enyl]morpholine (PubChem CID 102316233) has the molecular formula C7H9F4NO
and a molecular weight of 199.15 g/mol. Its IUPAC name is 4-[(Z)-2,3,3,3-tetrafluoroprop-1-enyl]morpholine.
Molecular Properties
| Compound Name | 4-[(Z)-2,3,3,3-tetrafluoroprop-1-enyl]morpholine |
| PubChem CID | 102316233 |
| Molecular Formula | C7H9F4NO |
| Molecular Weight | 199.15 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 4-[(Z)-2,3,3,3-tetrafluoroprop-1-enyl]morpholine |
| SMILES | F/C(=C\N1CCOCC1)C(F)(F)F |
| InChI | InChI=1S/C7H9F4NO/c8-6(7(9,10)11)5-12-1-3-13-4-2-12/h5H,1-4H2/b6-5- |
| InChIKey | FMDXAYGQJHKDKE-WAYWQWQTSA-N |
| XLogP | 1.69 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.15 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[(Z)-2,3,3,3-tetrafluoroprop-1-enyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(Z)-2,3,3,3-tetrafluoroprop-1-enyl]morpholine?
The IUPAC name of 4-[(Z)-2,3,3,3-tetrafluoroprop-1-enyl]morpholine (CID 102316233) is 4-[(Z)-2,3,3,3-tetrafluoroprop-1-enyl]morpholine.
What is the SMILES notation for 4-[(Z)-2,3,3,3-tetrafluoroprop-1-enyl]morpholine?
The canonical SMILES for 4-[(Z)-2,3,3,3-tetrafluoroprop-1-enyl]morpholine is F/C(=C\N1CCOCC1)C(F)(F)F.
What is the InChIKey of 4-[(Z)-2,3,3,3-tetrafluoroprop-1-enyl]morpholine?
The InChIKey is FMDXAYGQJHKDKE-WAYWQWQTSA-N. The full InChI is InChI=1S/C7H9F4NO/c8-6(7(9,10)11)5-12-1-3-13-4-2-12/h5H,1-4H2/b6-5-.
What are the key properties of 4-[(Z)-2,3,3,3-tetrafluoroprop-1-enyl]morpholine?
4-[(Z)-2,3,3,3-tetrafluoroprop-1-enyl]morpholine has a molecular weight of 199.15 g/mol, XLogP of 1.69, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(Z)-2,3,3,3-tetrafluoroprop-1-enyl]morpholine is sourced from PubChem (CID 102316233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).