C21H21NO3S — CID 102316398
N-[(1R,2S)-2-hydroxy-1,2-diphenylethyl]-4-methylbenzenesulfonamide (PubChem CID 102316398) has the molecular formula C21H21NO3S and a molecular weight of 367.47 g/mol. Its IUPAC name is N-[(1R,2S)-2-hydroxy-1,2-diphenylethyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(1R,2S)-2-hydroxy-1,2-diphenylethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 102316398 |
| Molecular Formula | C21H21NO3S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | N-[(1R,2S)-2-hydroxy-1,2-diphenylethyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H](c2ccccc2)[C@@H](O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H21NO3S/c1-16-12-14-19(15-13-16)26(24,25)22-20(17-8-4-2-5-9-17)21(23)18-10-6-3-7-11-18/h2-15,20-23H,1H3/t20-,21+/m1/s1 |
| InChIKey | URVQPPFOCBAUNE-RTWAWAEBSA-N |
| XLogP | 3.75 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |