C20H24O8 — CID 102316545
2-[(1S,6S,7S,11R,13R,16R,17S)-7-hydroxy-6,10,16-trimethyl-4,8,15-trioxo-3,14-dioxatetracyclo[11.4.0.01,5.06,11]heptadec-9-en-17-yl]acetic acid (PubChem CID 102316545) has the molecular formula C20H24O8 and a molecular weight of 392.40 g/mol. Its IUPAC name is 2-[(1S,6S,7S,11R,13R,16R,17S)-7-hydroxy-6,10,16-trimethyl-4,8,15-trioxo-3,14-dioxatetracyclo[11.4.0.01,5.06,11]heptadec-9-en-17-yl]acetic acid.
| Compound Name | 2-[(1S,6S,7S,11R,13R,16R,17S)-7-hydroxy-6,10,16-trimethyl-4,8,15-trioxo-3,14-dioxatetracyclo[11.4.0.01,5.06,11]heptadec-9-en-17-yl]acetic acid |
|---|---|
| PubChem CID | 102316545 |
| Molecular Formula | C20H24O8 |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 2-[(1S,6S,7S,11R,13R,16R,17S)-7-hydroxy-6,10,16-trimethyl-4,8,15-trioxo-3,14-dioxatetracyclo[11.4.0.01,5.06,11]heptadec-9-en-17-yl]acetic acid |
| SMILES | CC1=CC(=O)[C@@H](O)[C@]2(C)C3C(=O)OC[C@@]34[C@@H](C[C@H]12)OC(=O)[C@H](C)[C@@H]4CC(=O)O |
| InChI | InChI=1S/C20H24O8/c1-8-4-12(21)16(24)19(3)10(8)5-13-20(7-27-18(26)15(19)20)11(6-14(22)23)9(2)17(25)28-13/h4,9-11,13,15-16,24H,5-7H2,1-3H3,(H,22,23)/t9-,10-,11+,13-,15?,16-,19+,20-/m1/s1 |
| InChIKey | HEARPDWGNHOTSL-VRQCDGKKSA-N |
| XLogP | 0.71 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |