C26H26O7 — CID 102316581
(2S,3R)-2-(4-hydroxy-3,5-dimethoxyphenyl)-11-methoxy-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromene-3,8-diol (PubChem CID 102316581) has the molecular formula C26H26O7 and a molecular weight of 450.49 g/mol. Its IUPAC name is (2S,3R)-2-(4-hydroxy-3,5-dimethoxyphenyl)-11-methoxy-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromene-3,8-diol.
| Compound Name | (2S,3R)-2-(4-hydroxy-3,5-dimethoxyphenyl)-11-methoxy-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromene-3,8-diol |
|---|---|
| PubChem CID | 102316581 |
| Molecular Formula | C26H26O7 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | (2S,3R)-2-(4-hydroxy-3,5-dimethoxyphenyl)-11-methoxy-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromene-3,8-diol |
| SMILES | COc1cc([C@@H]2Oc3cc(OC)c4c(c3C[C@H]2O)CCc2cc(O)ccc2-4)cc(OC)c1O |
| InChI | InChI=1S/C26H26O7/c1-30-21-12-20-18(17-6-4-13-8-15(27)5-7-16(13)24(17)21)11-19(28)26(33-20)14-9-22(31-2)25(29)23(10-14)32-3/h5,7-10,12,19,26-29H,4,6,11H2,1-3H3/t19-,26+/m1/s1 |
| InChIKey | JRKFVXPFQQFSJD-BCHFMIIMSA-N |
| XLogP | 3.93 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |