C25H24O6 — CID 102316582
(3S,4S)-3-(4-hydroxy-3-methoxyphenyl)-11-methoxy-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromene-4,8-diol (PubChem CID 102316582) has the molecular formula C25H24O6 and a molecular weight of 420.46 g/mol. Its IUPAC name is (3S,4S)-3-(4-hydroxy-3-methoxyphenyl)-11-methoxy-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromene-4,8-diol.
| Compound Name | (3S,4S)-3-(4-hydroxy-3-methoxyphenyl)-11-methoxy-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromene-4,8-diol |
|---|---|
| PubChem CID | 102316582 |
| Molecular Formula | C25H24O6 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | (3S,4S)-3-(4-hydroxy-3-methoxyphenyl)-11-methoxy-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromene-4,8-diol |
| SMILES | COc1cc([C@H]2COc3cc(OC)c4c(c3[C@H]2O)CCc2cc(O)ccc2-4)ccc1O |
| InChI | InChI=1S/C25H24O6/c1-29-20-10-14(4-8-19(20)27)18-12-31-22-11-21(30-2)23-16-7-5-15(26)9-13(16)3-6-17(23)24(22)25(18)28/h4-5,7-11,18,25-28H,3,6,12H2,1-2H3/t18-,25+/m1/s1 |
| InChIKey | DARDHUFDRYDZMZ-CJAUYULYSA-N |
| XLogP | 4.09 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |