C5H7F3INO2S — CID 102316648
(2R)-2-[(1R)-1-iodoethyl]-1-(trifluoromethylsulfonyl)aziridine (PubChem CID 102316648) has the molecular formula C5H7F3INO2S and a molecular weight of 329.08 g/mol. Its IUPAC name is (2R)-2-[(1R)-1-iodoethyl]-1-(trifluoromethylsulfonyl)aziridine.
| Compound Name | (2R)-2-[(1R)-1-iodoethyl]-1-(trifluoromethylsulfonyl)aziridine |
|---|---|
| PubChem CID | 102316648 |
| Molecular Formula | C5H7F3INO2S |
| Molecular Weight | 329.08 g/mol |
| Exact Mass | 328.92 |
| IUPAC Name | (2R)-2-[(1R)-1-iodoethyl]-1-(trifluoromethylsulfonyl)aziridine |
| SMILES | C[C@@H](I)[C@H]1CN1S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C5H7F3INO2S/c1-3(9)4-2-10(4)13(11,12)5(6,7)8/h3-4H,2H2,1H3/t3-,4-,10?/m1/s1 |
| InChIKey | QXZMMGISSWKVRD-SQNKIGGZSA-N |
| XLogP | 1.34 |
| TPSA | 37.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.08 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|