C28H24O16 — CID 102316677
[(2S,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[5-hydroxy-7-oxo-2-(3,4,5-trihydroxyphenyl)chromen-3-yl]oxyoxan-3-yl] 3,4,5-trihydroxybenzoate (PubChem CID 102316677) has the molecular formula C28H24O16 and a molecular weight of 616.48 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[5-hydroxy-7-oxo-2-(3,4,5-trihydroxyphenyl)chromen-3-yl]oxyoxan-3-yl] 3,4,5-trihydroxybenzoate.
| Compound Name | [(2S,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[5-hydroxy-7-oxo-2-(3,4,5-trihydroxyphenyl)chromen-3-yl]oxyoxan-3-yl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 102316677 |
| Molecular Formula | C28H24O16 |
| Molecular Weight | 616.48 g/mol |
| Exact Mass | 616.11 |
| IUPAC Name | [(2S,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[5-hydroxy-7-oxo-2-(3,4,5-trihydroxyphenyl)chromen-3-yl]oxyoxan-3-yl] 3,4,5-trihydroxybenzoate |
| SMILES | O=C(O[C@H]1[C@H](Oc2cc3c(O)cc(=O)cc-3oc2-c2cc(O)c(O)c(O)c2)O[C@H](CO)[C@H](O)[C@@H]1O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C28H24O16/c29-8-20-23(38)24(39)26(44-27(40)10-3-16(34)22(37)17(35)4-10)28(43-20)42-19-7-12-13(31)5-11(30)6-18(12)41-25(19)9-1-14(32)21(36)15(33)2-9/h1-7,20,23-24,26,28-29,31-39H,8H2/t20-,23+,24+,26-,28-/m1/s1 |
| InChIKey | CJTDIFUVURPIFX-JGSGXJSYSA-N |
| XLogP | 0.39 |
| TPSA | 277.27 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.48 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|