C21H28O4 — CID 102317017
methyl 2-[(1R,5S,7R,8R)-7-ethenyl-5,9-dimethyl-4-oxo-2-propan-2-yl-12-oxatricyclo[5.4.1.01,5]dodeca-2,9-dien-8-yl]acetate (PubChem CID 102317017) has the molecular formula C21H28O4 and a molecular weight of 344.45 g/mol. Its IUPAC name is methyl 2-[(1R,5S,7R,8R)-7-ethenyl-5,9-dimethyl-4-oxo-2-propan-2-yl-12-oxatricyclo[5.4.1.01,5]dodeca-2,9-dien-8-yl]acetate.
| Compound Name | methyl 2-[(1R,5S,7R,8R)-7-ethenyl-5,9-dimethyl-4-oxo-2-propan-2-yl-12-oxatricyclo[5.4.1.01,5]dodeca-2,9-dien-8-yl]acetate |
|---|---|
| PubChem CID | 102317017 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | methyl 2-[(1R,5S,7R,8R)-7-ethenyl-5,9-dimethyl-4-oxo-2-propan-2-yl-12-oxatricyclo[5.4.1.01,5]dodeca-2,9-dien-8-yl]acetate |
| SMILES | C=C[C@]12C[C@]3(C)C(=O)C=C(C(C)C)[C@@]3(CC=C(C)[C@H]1CC(=O)OC)O2 |
| InChI | InChI=1S/C21H28O4/c1-7-20-12-19(5)17(22)10-15(13(2)3)21(19,25-20)9-8-14(4)16(20)11-18(23)24-6/h7-8,10,13,16H,1,9,11-12H2,2-6H3/t16-,19-,20+,21-/m1/s1 |
| InChIKey | UKAKVYDFSAPWKC-RZXSNQJFSA-N |
| XLogP | 3.77 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|