C10H15N5 — CID 102317289
2,4,6,8,15-pentazahexacyclo[7.5.1.03,13.05,12.07,11.010,14]pentadecane (PubChem CID 102317289) has the molecular formula C10H15N5 and a molecular weight of 205.27 g/mol. Its IUPAC name is 2,4,6,8,15-pentazahexacyclo[7.5.1.03,13.05,12.07,11.010,14]pentadecane.
| Compound Name | 2,4,6,8,15-pentazahexacyclo[7.5.1.03,13.05,12.07,11.010,14]pentadecane |
|---|---|
| PubChem CID | 102317289 |
| Molecular Formula | C10H15N5 |
| Molecular Weight | 205.27 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 2,4,6,8,15-pentazahexacyclo[7.5.1.03,13.05,12.07,11.010,14]pentadecane |
| SMILES | N1C2NC3NC4NC5NC1C1C2C3C4C51 |
| InChI | InChI=1S/C10H15N5/c11-6-1-2-4-5-3(1)8(12-6)14-10(5)15-9(4)13-7(2)11/h1-15H |
| InChIKey | NWQPRYVJBJJLJA-UHFFFAOYSA-N |
| XLogP | -2.27 |
| TPSA | 60.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.27 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |