C24H17F11N2O2 — CID 10231739
(2R)-1,1,1-trifluoro-3-[N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]-3-[[2-(trifluoromethyl)-4-pyridinyl]oxy]anilino]propan-2-ol (PubChem CID 10231739) has the molecular formula C24H17F11N2O2 and a molecular weight of 574.39 g/mol. Its IUPAC name is (2R)-1,1,1-trifluoro-3-[N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]-3-[[2-(trifluoromethyl)-4-pyridinyl]oxy]anilino]propan-2-ol.
| Compound Name | (2R)-1,1,1-trifluoro-3-[N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]-3-[[2-(trifluoromethyl)-4-pyridinyl]oxy]anilino]propan-2-ol |
|---|---|
| PubChem CID | 10231739 |
| Molecular Formula | C24H17F11N2O2 |
| Molecular Weight | 574.39 g/mol |
| Exact Mass | 574.11 |
| IUPAC Name | (2R)-1,1,1-trifluoro-3-[N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]-3-[[2-(trifluoromethyl)-4-pyridinyl]oxy]anilino]propan-2-ol |
| SMILES | O[C@H](CN(Cc1cccc(C(F)(F)C(F)(F)F)c1)c1cccc(Oc2ccnc(C(F)(F)F)c2)c1)C(F)(F)F |
| InChI | InChI=1S/C24H17F11N2O2/c25-21(26,24(33,34)35)15-4-1-3-14(9-15)12-37(13-20(38)23(30,31)32)16-5-2-6-17(10-16)39-18-7-8-36-19(11-18)22(27,28)29/h1-11,20,38H,12-13H2/t20-/m1/s1 |
| InChIKey | SHKNMGATJUCZOD-HXUWFJFHSA-N |
| XLogP | 7.48 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.39 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|