C26H29F7N6O — CID 10231741
1-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-(4-fluorophenyl)ethyl]-4-[4-(2H-tetrazol-5-yl)butyl]piperazine (PubChem CID 10231741) has the molecular formula C26H29F7N6O and a molecular weight of 574.55 g/mol. Its IUPAC name is 1-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-(4-fluorophenyl)ethyl]-4-[4-(2H-tetrazol-5-yl)butyl]piperazine.
| Compound Name | 1-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-(4-fluorophenyl)ethyl]-4-[4-(2H-tetrazol-5-yl)butyl]piperazine |
|---|---|
| PubChem CID | 10231741 |
| Molecular Formula | C26H29F7N6O |
| Molecular Weight | 574.55 g/mol |
| Exact Mass | 574.23 |
| IUPAC Name | 1-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-(4-fluorophenyl)ethyl]-4-[4-(2H-tetrazol-5-yl)butyl]piperazine |
| SMILES | Fc1ccc(C(COCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)N2CCN(CCCCc3nn[nH]n3)CC2)cc1 |
| InChI | InChI=1S/C26H29F7N6O/c27-22-6-4-19(5-7-22)23(39-11-9-38(10-12-39)8-2-1-3-24-34-36-37-35-24)17-40-16-18-13-20(25(28,29)30)15-21(14-18)26(31,32)33/h4-7,13-15,23H,1-3,8-12,16-17H2,(H,34,35,36,37) |
| InChIKey | DKIAULIAAPSNLO-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 70.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.55 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|