C7H14O2 — CID 102317683
(2S,4R)-2-ethoxy-4-methyloxolane (PubChem CID 102317683) has the molecular formula C7H14O2 and a molecular weight of 130.19 g/mol. Its IUPAC name is (2S,4R)-2-ethoxy-4-methyloxolane.
| Compound Name | (2S,4R)-2-ethoxy-4-methyloxolane |
|---|---|
| PubChem CID | 102317683 |
| Molecular Formula | C7H14O2 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.10 |
| IUPAC Name | (2S,4R)-2-ethoxy-4-methyloxolane |
| SMILES | CCO[C@@H]1C[C@@H](C)CO1 |
| InChI | InChI=1S/C7H14O2/c1-3-8-7-4-6(2)5-9-7/h6-7H,3-5H2,1-2H3/t6-,7+/m1/s1 |
| InChIKey | HRCSYWMVHCNFAK-RQJHMYQMSA-N |
| XLogP | 1.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |