C14H24O3 — CID 102317731
(3S,3aR,7aR)-3-heptyl-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-one (PubChem CID 102317731) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is (3S,3aR,7aR)-3-heptyl-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-one.
| Compound Name | (3S,3aR,7aR)-3-heptyl-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-one |
|---|---|
| PubChem CID | 102317731 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | (3S,3aR,7aR)-3-heptyl-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-one |
| SMILES | CCCCCCC[C@@H]1C(=O)O[C@@H]2CCCO[C@H]12 |
| InChI | InChI=1S/C14H24O3/c1-2-3-4-5-6-8-11-13-12(17-14(11)15)9-7-10-16-13/h11-13H,2-10H2,1H3/t11-,12+,13+/m0/s1 |
| InChIKey | QENACQXPAVIIDZ-YNEHKIRRSA-N |
| XLogP | 3.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|