C10H16O3 — CID 102317732
(3S,3aR,7aR)-3-propan-2-yl-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-one (PubChem CID 102317732) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is (3S,3aR,7aR)-3-propan-2-yl-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-one.
| Compound Name | (3S,3aR,7aR)-3-propan-2-yl-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-one |
|---|---|
| PubChem CID | 102317732 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | (3S,3aR,7aR)-3-propan-2-yl-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-one |
| SMILES | CC(C)[C@@H]1C(=O)O[C@@H]2CCCO[C@@H]21 |
| InChI | InChI=1S/C10H16O3/c1-6(2)8-9-7(13-10(8)11)4-3-5-12-9/h6-9H,3-5H2,1-2H3/t7-,8+,9+/m1/s1 |
| InChIKey | CBXKWWDELFTVHZ-VGMNWLOBSA-N |
| XLogP | 1.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |