C31H43NO8 — CID 102318062
[(3S,4S,5R,6R)-4,5-bis(2,2-dimethylpropanoyloxy)-6-[(2R)-4-oxo-2-phenyl-2,3-dihydropyridin-1-yl]oxan-3-yl] 2,2-dimethylpropanoate (PubChem CID 102318062) has the molecular formula C31H43NO8 and a molecular weight of 557.68 g/mol. Its IUPAC name is [(3S,4S,5R,6R)-4,5-bis(2,2-dimethylpropanoyloxy)-6-[(2R)-4-oxo-2-phenyl-2,3-dihydropyridin-1-yl]oxan-3-yl] 2,2-dimethylpropanoate.
| Compound Name | [(3S,4S,5R,6R)-4,5-bis(2,2-dimethylpropanoyloxy)-6-[(2R)-4-oxo-2-phenyl-2,3-dihydropyridin-1-yl]oxan-3-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 102318062 |
| Molecular Formula | C31H43NO8 |
| Molecular Weight | 557.68 g/mol |
| Exact Mass | 557.30 |
| IUPAC Name | [(3S,4S,5R,6R)-4,5-bis(2,2-dimethylpropanoyloxy)-6-[(2R)-4-oxo-2-phenyl-2,3-dihydropyridin-1-yl]oxan-3-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)O[C@@H]1[C@@H](OC(=O)C(C)(C)C)[C@H](N2C=CC(=O)C[C@@H]2c2ccccc2)OC[C@@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C31H43NO8/c1-29(2,3)26(34)38-22-18-37-25(32-16-15-20(33)17-21(32)19-13-11-10-12-14-19)24(40-28(36)31(7,8)9)23(22)39-27(35)30(4,5)6/h10-16,21-25H,17-18H2,1-9H3/t21-,22+,23+,24-,25-/m1/s1 |
| InChIKey | JXZSBZWRIQTVLE-ZLOLNMDISA-N |
| XLogP | 4.75 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.68 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|