About trans-ethyl (1R,6S)-1-methyl-2-oxo-6-(4-trimethylsilylbut-3-ynyl)cyclohexane-1-carboxylate
trans-ethyl (1R,6S)-1-methyl-2-oxo-6-(4-trimethylsilylbut-3-ynyl)cyclohexane-1-carboxylate (PubChem CID 102318203) has the molecular formula C17H28O3Si
and a molecular weight of 308.49 g/mol. Its IUPAC name is trans-ethyl (1R,6S)-1-methyl-2-oxo-6-(4-trimethylsilylbut-3-ynyl)cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | trans-ethyl (1R,6S)-1-methyl-2-oxo-6-(4-trimethylsilylbut-3-ynyl)cyclohexane-1-carboxylate |
| PubChem CID | 102318203 |
| Molecular Formula | C17H28O3Si |
| Molecular Weight | 308.49 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | trans-ethyl (1R,6S)-1-methyl-2-oxo-6-(4-trimethylsilylbut-3-ynyl)cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)[C@@]1(C)C(=O)CCC[C@H]1CCC#C[Si](C)(C)C |
| InChI | InChI=1S/C17H28O3Si/c1-6-20-16(19)17(2)14(11-9-12-15(17)18)10-7-8-13-21(3,4)5/h14H,6-7,9-12H2,1-5H3/t14-,17-/m1/s1 |
| InChIKey | YWGYFRYDJLAHFC-RHSMWYFYSA-N |
| XLogP | 3.59 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze trans-ethyl (1R,6S)-1-methyl-2-oxo-6-(4-trimethylsilylbut-3-ynyl)cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-ethyl (1R,6S)-1-methyl-2-oxo-6-(4-trimethylsilylbut-3-ynyl)cyclohexane-1-carboxylate?
The IUPAC name of trans-ethyl (1R,6S)-1-methyl-2-oxo-6-(4-trimethylsilylbut-3-ynyl)cyclohexane-1-carboxylate (CID 102318203) is trans-ethyl (1R,6S)-1-methyl-2-oxo-6-(4-trimethylsilylbut-3-ynyl)cyclohexane-1-carboxylate.
What is the SMILES notation for trans-ethyl (1R,6S)-1-methyl-2-oxo-6-(4-trimethylsilylbut-3-ynyl)cyclohexane-1-carboxylate?
The canonical SMILES for trans-ethyl (1R,6S)-1-methyl-2-oxo-6-(4-trimethylsilylbut-3-ynyl)cyclohexane-1-carboxylate is CCOC(=O)[C@@]1(C)C(=O)CCC[C@H]1CCC#C[Si](C)(C)C.
What is the InChIKey of trans-ethyl (1R,6S)-1-methyl-2-oxo-6-(4-trimethylsilylbut-3-ynyl)cyclohexane-1-carboxylate?
The InChIKey is YWGYFRYDJLAHFC-RHSMWYFYSA-N. The full InChI is InChI=1S/C17H28O3Si/c1-6-20-16(19)17(2)14(11-9-12-15(17)18)10-7-8-13-21(3,4)5/h14H,6-7,9-12H2,1-5H3/t14-,17-/m1/s1.
What are the key properties of trans-ethyl (1R,6S)-1-methyl-2-oxo-6-(4-trimethylsilylbut-3-ynyl)cyclohexane-1-carboxylate?
trans-ethyl (1R,6S)-1-methyl-2-oxo-6-(4-trimethylsilylbut-3-ynyl)cyclohexane-1-carboxylate has a molecular weight of 308.49 g/mol, XLogP of 3.59, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-ethyl (1R,6S)-1-methyl-2-oxo-6-(4-trimethylsilylbut-3-ynyl)cyclohexane-1-carboxylate is sourced from PubChem (CID 102318203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).