C13H18O3 — CID 102318454
(1S,2S,4S)-2-[1-(methoxymethoxy)prop-2-enyl]bicyclo[2.2.1]hept-5-ene-2-carbaldehyde (PubChem CID 102318454) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is (1S,2S,4S)-2-[1-(methoxymethoxy)prop-2-enyl]bicyclo[2.2.1]hept-5-ene-2-carbaldehyde.
| Compound Name | (1S,2S,4S)-2-[1-(methoxymethoxy)prop-2-enyl]bicyclo[2.2.1]hept-5-ene-2-carbaldehyde |
|---|---|
| PubChem CID | 102318454 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | (1S,2S,4S)-2-[1-(methoxymethoxy)prop-2-enyl]bicyclo[2.2.1]hept-5-ene-2-carbaldehyde |
| SMILES | C=CC(OCOC)[C@]1(C=O)C[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C13H18O3/c1-3-12(16-9-15-2)13(8-14)7-10-4-5-11(13)6-10/h3-5,8,10-12H,1,6-7,9H2,2H3/t10-,11+,12?,13-/m0/s1 |
| InChIKey | JKRXJDTYOYHCNE-HNGCFSAESA-N |
| XLogP | 1.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|