C17H24O3 — CID 102318456
1-[(1S,2S,4S)-2-[1-(methoxymethoxy)prop-2-enyl]-2-bicyclo[2.2.1]hept-5-enyl]pent-4-en-1-one (PubChem CID 102318456) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is 1-[(1S,2S,4S)-2-[1-(methoxymethoxy)prop-2-enyl]-2-bicyclo[2.2.1]hept-5-enyl]pent-4-en-1-one.
| Compound Name | 1-[(1S,2S,4S)-2-[1-(methoxymethoxy)prop-2-enyl]-2-bicyclo[2.2.1]hept-5-enyl]pent-4-en-1-one |
|---|---|
| PubChem CID | 102318456 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 1-[(1S,2S,4S)-2-[1-(methoxymethoxy)prop-2-enyl]-2-bicyclo[2.2.1]hept-5-enyl]pent-4-en-1-one |
| SMILES | C=CCCC(=O)[C@@]1(C(C=C)OCOC)C[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C17H24O3/c1-4-6-7-15(18)17(16(5-2)20-12-19-3)11-13-8-9-14(17)10-13/h4-5,8-9,13-14,16H,1-2,6-7,10-12H2,3H3/t13-,14+,16?,17+/m0/s1 |
| InChIKey | WYJPAHUVCQARBA-VMTUKWTFSA-N |
| XLogP | 3.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|