C16H18ClF3N2O3 — CID 102318808
ethyl 2-[(2S,3S,5R)-1-acetyl-3-(6-chloro-3-pyridinyl)-5-(trifluoromethyl)pyrrolidin-2-yl]acetate (PubChem CID 102318808) has the molecular formula C16H18ClF3N2O3 and a molecular weight of 378.78 g/mol. Its IUPAC name is ethyl 2-[(2S,3S,5R)-1-acetyl-3-(6-chloro-3-pyridinyl)-5-(trifluoromethyl)pyrrolidin-2-yl]acetate.
| Compound Name | ethyl 2-[(2S,3S,5R)-1-acetyl-3-(6-chloro-3-pyridinyl)-5-(trifluoromethyl)pyrrolidin-2-yl]acetate |
|---|---|
| PubChem CID | 102318808 |
| Molecular Formula | C16H18ClF3N2O3 |
| Molecular Weight | 378.78 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | ethyl 2-[(2S,3S,5R)-1-acetyl-3-(6-chloro-3-pyridinyl)-5-(trifluoromethyl)pyrrolidin-2-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1[C@H](c2ccc(Cl)nc2)C[C@H](C(F)(F)F)N1C(C)=O |
| InChI | InChI=1S/C16H18ClF3N2O3/c1-3-25-15(24)7-12-11(10-4-5-14(17)21-8-10)6-13(16(18,19)20)22(12)9(2)23/h4-5,8,11-13H,3,6-7H2,1-2H3/t11-,12-,13+/m0/s1 |
| InChIKey | GQVZKILOAVZVMX-RWMBFGLXSA-N |
| XLogP | 3.32 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.78 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|