C15H20O — CID 102318875
(2S,3S,5Z,7E)-3-methyl-8-phenylocta-5,7-dien-2-ol (PubChem CID 102318875) has the molecular formula C15H20O and a molecular weight of 216.32 g/mol. Its IUPAC name is (2S,3S,5Z,7E)-3-methyl-8-phenylocta-5,7-dien-2-ol.
| Compound Name | (2S,3S,5Z,7E)-3-methyl-8-phenylocta-5,7-dien-2-ol |
|---|---|
| PubChem CID | 102318875 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | (2S,3S,5Z,7E)-3-methyl-8-phenylocta-5,7-dien-2-ol |
| SMILES | C[C@H](O)[C@@H](C)C/C=C\C=C\c1ccccc1 |
| InChI | InChI=1S/C15H20O/c1-13(14(2)16)9-5-3-6-10-15-11-7-4-8-12-15/h3-8,10-14,16H,9H2,1-2H3/b5-3-,10-6+/t13-,14-/m0/s1 |
| InChIKey | ARROMLOSFCWJKF-CADGQSGLSA-N |
| XLogP | 3.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|