C13H20N4 — CID 102318901
5,5-ditert-butyl-1,4-dihydropyrazole-3,4-dicarbonitrile (PubChem CID 102318901) has the molecular formula C13H20N4 and a molecular weight of 232.33 g/mol. Its IUPAC name is 5,5-ditert-butyl-1,4-dihydropyrazole-3,4-dicarbonitrile.
| Compound Name | 5,5-ditert-butyl-1,4-dihydropyrazole-3,4-dicarbonitrile |
|---|---|
| PubChem CID | 102318901 |
| Molecular Formula | C13H20N4 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | 5,5-ditert-butyl-1,4-dihydropyrazole-3,4-dicarbonitrile |
| SMILES | CC(C)(C)C1(C(C)(C)C)NN=C(C#N)C1C#N |
| InChI | InChI=1S/C13H20N4/c1-11(2,3)13(12(4,5)6)9(7-14)10(8-15)16-17-13/h9,17H,1-6H3 |
| InChIKey | XRNLQRCTAVTAEK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 71.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |