About 2-cyclohexylideneethyl phosphono hydrogen phosphate
2-cyclohexylideneethyl phosphono hydrogen phosphate (PubChem CID 102318977) has the molecular formula C8H16O7P2
and a molecular weight of 286.16 g/mol. Its IUPAC name is 2-cyclohexylideneethyl phosphono hydrogen phosphate.
Molecular Properties
| Compound Name | 2-cyclohexylideneethyl phosphono hydrogen phosphate |
| PubChem CID | 102318977 |
| Molecular Formula | C8H16O7P2 |
| Molecular Weight | 286.16 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 2-cyclohexylideneethyl phosphono hydrogen phosphate |
| SMILES | O=P(O)(O)OP(=O)(O)OCC=C1CCCCC1 |
| InChI | InChI=1S/C8H16O7P2/c9-16(10,11)15-17(12,13)14-7-6-8-4-2-1-3-5-8/h6H,1-5,7H2,(H,12,13)(H2,9,10,11) |
| InChIKey | QUTBLCAVPGVKSW-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.16 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexylideneethyl phosphono hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexylideneethyl phosphono hydrogen phosphate?
The IUPAC name of 2-cyclohexylideneethyl phosphono hydrogen phosphate (CID 102318977) is 2-cyclohexylideneethyl phosphono hydrogen phosphate.
What is the SMILES notation for 2-cyclohexylideneethyl phosphono hydrogen phosphate?
The canonical SMILES for 2-cyclohexylideneethyl phosphono hydrogen phosphate is O=P(O)(O)OP(=O)(O)OCC=C1CCCCC1.
What is the InChIKey of 2-cyclohexylideneethyl phosphono hydrogen phosphate?
The InChIKey is QUTBLCAVPGVKSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O7P2/c9-16(10,11)15-17(12,13)14-7-6-8-4-2-1-3-5-8/h6H,1-5,7H2,(H,12,13)(H2,9,10,11).
What are the key properties of 2-cyclohexylideneethyl phosphono hydrogen phosphate?
2-cyclohexylideneethyl phosphono hydrogen phosphate has a molecular weight of 286.16 g/mol, XLogP of 2.10, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexylideneethyl phosphono hydrogen phosphate is sourced from PubChem (CID 102318977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).