About 2-amino-3,7-bis[[4-[4-(chloromethyl)phenyl]phenyl]methyl]purin-6-one
2-amino-3,7-bis[[4-[4-(chloromethyl)phenyl]phenyl]methyl]purin-6-one (PubChem CID 10231900) has the molecular formula C33H27Cl2N5O
and a molecular weight of 580.52 g/mol. Its IUPAC name is 2-amino-3,7-bis[[4-[4-(chloromethyl)phenyl]phenyl]methyl]purin-6-one.
Molecular Properties
| Compound Name | 2-amino-3,7-bis[[4-[4-(chloromethyl)phenyl]phenyl]methyl]purin-6-one |
| PubChem CID | 10231900 |
| Molecular Formula | C33H27Cl2N5O |
| Molecular Weight | 580.52 g/mol |
| Exact Mass | 579.16 |
| IUPAC Name | 2-amino-3,7-bis[[4-[4-(chloromethyl)phenyl]phenyl]methyl]purin-6-one |
| SMILES | Nc1nc(=O)c2c(ncn2Cc2ccc(-c3ccc(CCl)cc3)cc2)n1Cc1ccc(-c2ccc(CCl)cc2)cc1 |
| InChI | InChI=1S/C33H27Cl2N5O/c34-17-22-1-9-26(10-2-22)28-13-5-24(6-14-28)19-39-21-37-31-30(39)32(41)38-33(36)40(31)20-25-7-15-29(16-8-25)27-11-3-23(18-35)4-12-27/h1-16,21H,17-20H2,(H2,36,38,41) |
| InChIKey | FGFMEIVHMWXCKK-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 78.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 580.52 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3,7-bis[[4-[4-(chloromethyl)phenyl]phenyl]methyl]purin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3,7-bis[[4-[4-(chloromethyl)phenyl]phenyl]methyl]purin-6-one?
The IUPAC name of 2-amino-3,7-bis[[4-[4-(chloromethyl)phenyl]phenyl]methyl]purin-6-one (CID 10231900) is 2-amino-3,7-bis[[4-[4-(chloromethyl)phenyl]phenyl]methyl]purin-6-one.
What is the SMILES notation for 2-amino-3,7-bis[[4-[4-(chloromethyl)phenyl]phenyl]methyl]purin-6-one?
The canonical SMILES for 2-amino-3,7-bis[[4-[4-(chloromethyl)phenyl]phenyl]methyl]purin-6-one is Nc1nc(=O)c2c(ncn2Cc2ccc(-c3ccc(CCl)cc3)cc2)n1Cc1ccc(-c2ccc(CCl)cc2)cc1.
What is the InChIKey of 2-amino-3,7-bis[[4-[4-(chloromethyl)phenyl]phenyl]methyl]purin-6-one?
The InChIKey is FGFMEIVHMWXCKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H27Cl2N5O/c34-17-22-1-9-26(10-2-22)28-13-5-24(6-14-28)19-39-21-37-31-30(39)32(41)38-33(36)40(31)20-25-7-15-29(16-8-25)27-11-3-23(18-35)4-12-27/h1-16,21H,17-20H2,(H2,36,38,41).
What are the key properties of 2-amino-3,7-bis[[4-[4-(chloromethyl)phenyl]phenyl]methyl]purin-6-one?
2-amino-3,7-bis[[4-[4-(chloromethyl)phenyl]phenyl]methyl]purin-6-one has a molecular weight of 580.52 g/mol, XLogP of 7.08, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3,7-bis[[4-[4-(chloromethyl)phenyl]phenyl]methyl]purin-6-one is sourced from PubChem (CID 10231900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).