C18H18O6 — CID 102319604
(3R)-3-[(3,4-dimethoxyphenyl)methyl]-3,7-dihydroxy-2H-chromen-4-one (PubChem CID 102319604) has the molecular formula C18H18O6 and a molecular weight of 330.34 g/mol. Its IUPAC name is (3R)-3-[(3,4-dimethoxyphenyl)methyl]-3,7-dihydroxy-2H-chromen-4-one.
| Compound Name | (3R)-3-[(3,4-dimethoxyphenyl)methyl]-3,7-dihydroxy-2H-chromen-4-one |
|---|---|
| PubChem CID | 102319604 |
| Molecular Formula | C18H18O6 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | (3R)-3-[(3,4-dimethoxyphenyl)methyl]-3,7-dihydroxy-2H-chromen-4-one |
| SMILES | COc1ccc(C[C@@]2(O)COc3cc(O)ccc3C2=O)cc1OC |
| InChI | InChI=1S/C18H18O6/c1-22-14-6-3-11(7-16(14)23-2)9-18(21)10-24-15-8-12(19)4-5-13(15)17(18)20/h3-8,19,21H,9-10H2,1-2H3/t18-/m1/s1 |
| InChIKey | HNAXLFVAWWUNKB-GOSISDBHSA-N |
| XLogP | 1.96 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |