C12H14I2O4 — CID 102319805
dimethyl (1S,3S,5S,7S)-5,7-diiodotricyclo[3.3.0.03,7]octane-1,3-dicarboxylate (PubChem CID 102319805) has the molecular formula C12H14I2O4 and a molecular weight of 476.05 g/mol. Its IUPAC name is dimethyl (1S,3S,5S,7S)-5,7-diiodotricyclo[3.3.0.03,7]octane-1,3-dicarboxylate.
| Compound Name | dimethyl (1S,3S,5S,7S)-5,7-diiodotricyclo[3.3.0.03,7]octane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 102319805 |
| Molecular Formula | C12H14I2O4 |
| Molecular Weight | 476.05 g/mol |
| Exact Mass | 475.90 |
| IUPAC Name | dimethyl (1S,3S,5S,7S)-5,7-diiodotricyclo[3.3.0.03,7]octane-1,3-dicarboxylate |
| SMILES | COC(=O)[C@]12C[C@]3(I)C[C@@]1(I)C[C@]3(C(=O)OC)C2 |
| InChI | InChI=1S/C12H14I2O4/c1-17-7(15)9-3-10(8(16)18-2)5-11(9,13)6-12(10,14)4-9/h3-6H2,1-2H3/t9-,10-,11-,12-/m0/s1 |
| InChIKey | SJGBETSJUYXJSQ-BJDJZHNGSA-N |
| XLogP | 2.25 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.05 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|