C11F23N — CID 10231983
1,2,2,3,3,4,5,5,6,6-decafluoro-N-(1,1,2,2,3,3,3-heptafluoropropyl)-N,4-bis(trifluoromethyl)cyclohexan-1-amine (PubChem CID 10231983) has the molecular formula C11F23N and a molecular weight of 583.08 g/mol. Its IUPAC name is 1,2,2,3,3,4,5,5,6,6-decafluoro-N-(1,1,2,2,3,3,3-heptafluoropropyl)-N,4-bis(trifluoromethyl)cyclohexan-1-amine.
| Compound Name | 1,2,2,3,3,4,5,5,6,6-decafluoro-N-(1,1,2,2,3,3,3-heptafluoropropyl)-N,4-bis(trifluoromethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 10231983 |
| Molecular Formula | C11F23N |
| Molecular Weight | 583.08 g/mol |
| Exact Mass | 582.97 |
| IUPAC Name | 1,2,2,3,3,4,5,5,6,6-decafluoro-N-(1,1,2,2,3,3,3-heptafluoropropyl)-N,4-bis(trifluoromethyl)cyclohexan-1-amine |
| SMILES | FC(F)(F)N(C(F)(F)C(F)(F)C(F)(F)F)C1(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C11F23N/c12-1(8(24,25)26)2(13,14)4(17,18)7(23,5(19,20)3(1,15)16)35(11(32,33)34)10(30,31)6(21,22)9(27,28)29 |
| InChIKey | PVOLXNKAVSPSJH-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.08 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|