C19H26O3 — CID 102320335
(6aR,10aR)-9-(hydroxymethyl)-6,6-dimethyl-3-(2,2,3,3,3-pentadeuteriopropyl)-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol (PubChem CID 102320335) has the molecular formula C19H26O3 and a molecular weight of 307.44 g/mol. Its IUPAC name is (6aR,10aR)-9-(hydroxymethyl)-6,6-dimethyl-3-(2,2,3,3,3-pentadeuteriopropyl)-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol.
| Compound Name | (6aR,10aR)-9-(hydroxymethyl)-6,6-dimethyl-3-(2,2,3,3,3-pentadeuteriopropyl)-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol |
|---|---|
| PubChem CID | 102320335 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.22 |
| IUPAC Name | (6aR,10aR)-9-(hydroxymethyl)-6,6-dimethyl-3-(2,2,3,3,3-pentadeuteriopropyl)-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])Cc1cc(O)c2c(c1)OC(C)(C)[C@@H]1CCC(CO)=C[C@@H]21 |
| InChI | InChI=1S/C19H26O3/c1-4-5-12-9-16(21)18-14-8-13(11-20)6-7-15(14)19(2,3)22-17(18)10-12/h8-10,14-15,20-21H,4-7,11H2,1-3H3/t14-,15-/m1/s1/i1D3,4D2 |
| InChIKey | UWBCYGUAEGZJRC-AHTJCOIUSA-N |
| XLogP | 3.93 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|