C12H2F8OS2 — CID 102320513
2,3,4,5-tetrafluoro-6-(2,3,4,5-tetrafluoro-6-sulfanylphenyl)sulfanylphenol (PubChem CID 102320513) has the molecular formula C12H2F8OS2 and a molecular weight of 378.27 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-6-(2,3,4,5-tetrafluoro-6-sulfanylphenyl)sulfanylphenol.
| Compound Name | 2,3,4,5-tetrafluoro-6-(2,3,4,5-tetrafluoro-6-sulfanylphenyl)sulfanylphenol |
|---|---|
| PubChem CID | 102320513 |
| Molecular Formula | C12H2F8OS2 |
| Molecular Weight | 378.27 g/mol |
| Exact Mass | 377.94 |
| IUPAC Name | 2,3,4,5-tetrafluoro-6-(2,3,4,5-tetrafluoro-6-sulfanylphenyl)sulfanylphenol |
| SMILES | Oc1c(F)c(F)c(F)c(F)c1Sc1c(F)c(F)c(F)c(F)c1S |
| InChI | InChI=1S/C12H2F8OS2/c13-1-3(15)7(19)11(9(21)5(1)17)23-12-8(20)4(16)2(14)6(18)10(12)22/h21-22H |
| InChIKey | JAFXCAIGEKWBAY-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.27 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|