C44H64N4+2 — CID 102320897
N-[(4-tert-butylphenyl)methyl]-5-[4-[2-[1-[5-[(4-tert-butylphenyl)methylamino]pentyl]pyridin-1-ium-4-yl]ethyl]pyridin-1-ium-1-yl]pentan-1-amine (PubChem CID 102320897) has the molecular formula C44H64N4+2 and a molecular weight of 649.02 g/mol. Its IUPAC name is N-[(4-tert-butylphenyl)methyl]-5-[4-[2-[1-[5-[(4-tert-butylphenyl)methylamino]pentyl]pyridin-1-ium-4-yl]ethyl]pyridin-1-ium-1-yl]pentan-1-amine.
| Compound Name | N-[(4-tert-butylphenyl)methyl]-5-[4-[2-[1-[5-[(4-tert-butylphenyl)methylamino]pentyl]pyridin-1-ium-4-yl]ethyl]pyridin-1-ium-1-yl]pentan-1-amine |
|---|---|
| PubChem CID | 102320897 |
| Molecular Formula | C44H64N4+2 |
| Molecular Weight | 649.02 g/mol |
| Exact Mass | 648.51 |
| IUPAC Name | N-[(4-tert-butylphenyl)methyl]-5-[4-[2-[1-[5-[(4-tert-butylphenyl)methylamino]pentyl]pyridin-1-ium-4-yl]ethyl]pyridin-1-ium-1-yl]pentan-1-amine |
| SMILES | CC(C)(C)c1ccc(CNCCCCC[n+]2ccc(CCc3cc[n+](CCCCCNCc4ccc(C(C)(C)C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C44H64N4/c1-43(2,3)41-19-15-39(16-20-41)35-45-27-9-7-11-29-47-31-23-37(24-32-47)13-14-38-25-33-48(34-26-38)30-12-8-10-28-46-36-40-17-21-42(22-18-40)44(4,5)6/h15-26,31-34,45-46H,7-14,27-30,35-36H2,1-6H3/q+2 |
| InChIKey | IQPUGQHDPIBPJI-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 31.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.02 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|