C12H16O2 — CID 102320919
(3aS,8aS)-2,2-dimethyl-4,5,8,8a-tetrahydro-3aH-cyclopenta[f][1,3]benzodioxole (PubChem CID 102320919) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is (3aS,8aS)-2,2-dimethyl-4,5,8,8a-tetrahydro-3aH-cyclopenta[f][1,3]benzodioxole.
| Compound Name | (3aS,8aS)-2,2-dimethyl-4,5,8,8a-tetrahydro-3aH-cyclopenta[f][1,3]benzodioxole |
|---|---|
| PubChem CID | 102320919 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | (3aS,8aS)-2,2-dimethyl-4,5,8,8a-tetrahydro-3aH-cyclopenta[f][1,3]benzodioxole |
| SMILES | CC1(C)O[C@H]2CC3=C(CC=C3)C[C@@H]2O1 |
| InChI | InChI=1S/C12H16O2/c1-12(2)13-10-6-8-4-3-5-9(8)7-11(10)14-12/h3-4,10-11H,5-7H2,1-2H3/t10-,11-/m0/s1 |
| InChIKey | HRPCKPFSXLUQMI-QWRGUYRKSA-N |
| XLogP | 2.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |