C33H52N2O2 — CID 102321360
2,4-ditert-butyl-6-[[3-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]imidazolidin-1-yl]methyl]phenol (PubChem CID 102321360) has the molecular formula C33H52N2O2 and a molecular weight of 508.79 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[[3-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]imidazolidin-1-yl]methyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[[3-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]imidazolidin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 102321360 |
| Molecular Formula | C33H52N2O2 |
| Molecular Weight | 508.79 g/mol |
| Exact Mass | 508.40 |
| IUPAC Name | 2,4-ditert-butyl-6-[[3-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]imidazolidin-1-yl]methyl]phenol |
| SMILES | CC(C)(C)c1cc(CN2CCN(Cc3cc(C(C)(C)C)cc(C(C)(C)C)c3O)C2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C33H52N2O2/c1-30(2,3)24-15-22(28(36)26(17-24)32(7,8)9)19-34-13-14-35(21-34)20-23-16-25(31(4,5)6)18-27(29(23)37)33(10,11)12/h15-18,36-37H,13-14,19-21H2,1-12H3 |
| InChIKey | XRFTYVCAGISOLD-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.79 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|