C34H34P5+ — CID 102321379
1-tert-butyl-1,2,3,4,5-pentakis-phenylpentaphospholan-1-ium (PubChem CID 102321379) has the molecular formula C34H34P5+ and a molecular weight of 597.52 g/mol. Its IUPAC name is 1-tert-butyl-1,2,3,4,5-pentakis-phenylpentaphospholan-1-ium.
| Compound Name | 1-tert-butyl-1,2,3,4,5-pentakis-phenylpentaphospholan-1-ium |
|---|---|
| PubChem CID | 102321379 |
| Molecular Formula | C34H34P5+ |
| Molecular Weight | 597.52 g/mol |
| Exact Mass | 597.13 |
| IUPAC Name | 1-tert-butyl-1,2,3,4,5-pentakis-phenylpentaphospholan-1-ium |
| SMILES | CC(C)(C)[P+]1(c2ccccc2)P(c2ccccc2)P(c2ccccc2)P(c2ccccc2)P1c1ccccc1 |
| InChI | InChI=1S/C34H34P5/c1-34(2,3)39(33-27-17-8-18-28-33)37(31-23-13-6-14-24-31)35(29-19-9-4-10-20-29)36(30-21-11-5-12-22-30)38(39)32-25-15-7-16-26-32/h4-28H,1-3H3/q+1 |
| InChIKey | XHHLEYJMTRJBAV-UHFFFAOYSA-N |
| XLogP | 9.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.52 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|