About phenanthrene
phenanthrene (PubChem CID 102321644) has the molecular formula C14H8
and a molecular weight of 176.22 g/mol. Its IUPAC name is phenanthrene.
Molecular Properties
| Compound Name | phenanthrene |
| PubChem CID | 102321644 |
| Molecular Formula | C14H8 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | phenanthrene |
| SMILES | C1=CC=C2C(=C=Cc3ccccc32)C=1 |
| InChI | InChI=1S/C14H8/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13/h1,3-9H |
| InChIKey | XDRAJJKTRKPGRR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze phenanthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenanthrene?
The IUPAC name of phenanthrene (CID 102321644) is phenanthrene.
What is the SMILES notation for phenanthrene?
The canonical SMILES for phenanthrene is C1=CC=C2C(=C=Cc3ccccc32)C=1.
What is the InChIKey of phenanthrene?
The InChIKey is XDRAJJKTRKPGRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13/h1,3-9H.
What are the key properties of phenanthrene?
phenanthrene has a molecular weight of 176.22 g/mol, XLogP of 3.35, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for phenanthrene is sourced from PubChem (CID 102321644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).