C13H20O3 — CID 102322096
(2S,3aR,4S,7aS)-4-(methoxymethoxymethyl)-2-methyl-2,3,3a,4,7,7a-hexahydroinden-1-one (PubChem CID 102322096) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is (2S,3aR,4S,7aS)-4-(methoxymethoxymethyl)-2-methyl-2,3,3a,4,7,7a-hexahydroinden-1-one.
| Compound Name | (2S,3aR,4S,7aS)-4-(methoxymethoxymethyl)-2-methyl-2,3,3a,4,7,7a-hexahydroinden-1-one |
|---|---|
| PubChem CID | 102322096 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | (2S,3aR,4S,7aS)-4-(methoxymethoxymethyl)-2-methyl-2,3,3a,4,7,7a-hexahydroinden-1-one |
| SMILES | COCOC[C@H]1C=CC[C@@H]2C(=O)[C@@H](C)C[C@H]12 |
| InChI | InChI=1S/C13H20O3/c1-9-6-12-10(7-16-8-15-2)4-3-5-11(12)13(9)14/h3-4,9-12H,5-8H2,1-2H3/t9-,10+,11-,12+/m0/s1 |
| InChIKey | HILPVRRDTIOTRR-WHOHXGKFSA-N |
| XLogP | 2.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|