About 2-methylpropyl-oxo-phenyl-(2H-tetrazol-5-ylimino)-λ6-sulfane
2-methylpropyl-oxo-phenyl-(2H-tetrazol-5-ylimino)-λ6-sulfane (PubChem CID 102322315) has the molecular formula C11H15N5OS
and a molecular weight of 265.34 g/mol. Its IUPAC name is 2-methylpropyl-oxo-phenyl-(2H-tetrazol-5-ylimino)-λ6-sulfane.
Molecular Properties
| Compound Name | 2-methylpropyl-oxo-phenyl-(2H-tetrazol-5-ylimino)-λ6-sulfane |
| PubChem CID | 102322315 |
| Molecular Formula | C11H15N5OS |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 2-methylpropyl-oxo-phenyl-(2H-tetrazol-5-ylimino)-λ6-sulfane |
| SMILES | CC(C)CS(=O)(=Nc1nn[nH]n1)c1ccccc1 |
| InChI | InChI=1S/C11H15N5OS/c1-9(2)8-18(17,10-6-4-3-5-7-10)14-11-12-15-16-13-11/h3-7,9H,8H2,1-2H3,(H,12,13,15,16) |
| InChIKey | BRPOEWUNQKZGBS-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methylpropyl-oxo-phenyl-(2H-tetrazol-5-ylimino)-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl-oxo-phenyl-(2H-tetrazol-5-ylimino)-λ6-sulfane?
The IUPAC name of 2-methylpropyl-oxo-phenyl-(2H-tetrazol-5-ylimino)-λ6-sulfane (CID 102322315) is 2-methylpropyl-oxo-phenyl-(2H-tetrazol-5-ylimino)-λ6-sulfane.
What is the SMILES notation for 2-methylpropyl-oxo-phenyl-(2H-tetrazol-5-ylimino)-λ6-sulfane?
The canonical SMILES for 2-methylpropyl-oxo-phenyl-(2H-tetrazol-5-ylimino)-λ6-sulfane is CC(C)CS(=O)(=Nc1nn[nH]n1)c1ccccc1.
What is the InChIKey of 2-methylpropyl-oxo-phenyl-(2H-tetrazol-5-ylimino)-λ6-sulfane?
The InChIKey is BRPOEWUNQKZGBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N5OS/c1-9(2)8-18(17,10-6-4-3-5-7-10)14-11-12-15-16-13-11/h3-7,9H,8H2,1-2H3,(H,12,13,15,16).
What are the key properties of 2-methylpropyl-oxo-phenyl-(2H-tetrazol-5-ylimino)-λ6-sulfane?
2-methylpropyl-oxo-phenyl-(2H-tetrazol-5-ylimino)-λ6-sulfane has a molecular weight of 265.34 g/mol, XLogP of 2.01, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl-oxo-phenyl-(2H-tetrazol-5-ylimino)-λ6-sulfane is sourced from PubChem (CID 102322315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).