About [(E)-1,1-bis(benzenesulfonyl)-1-fluoro-4-trimethylsilylbut-3-en-2-yl] acetate
[(E)-1,1-bis(benzenesulfonyl)-1-fluoro-4-trimethylsilylbut-3-en-2-yl] acetate (PubChem CID 102322738) has the molecular formula C21H25FO6S2Si
and a molecular weight of 484.64 g/mol. Its IUPAC name is [(E)-1,1-bis(benzenesulfonyl)-1-fluoro-4-trimethylsilylbut-3-en-2-yl] acetate.
Molecular Properties
| Compound Name | [(E)-1,1-bis(benzenesulfonyl)-1-fluoro-4-trimethylsilylbut-3-en-2-yl] acetate |
| PubChem CID | 102322738 |
| Molecular Formula | C21H25FO6S2Si |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.08 |
| IUPAC Name | [(E)-1,1-bis(benzenesulfonyl)-1-fluoro-4-trimethylsilylbut-3-en-2-yl] acetate |
| SMILES | CC(=O)OC(/C=C/[Si](C)(C)C)C(F)(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H25FO6S2Si/c1-17(23)28-20(15-16-31(2,3)4)21(22,29(24,25)18-11-7-5-8-12-18)30(26,27)19-13-9-6-10-14-19/h5-16,20H,1-4H3/b16-15+ |
| InChIKey | BWFLNHCVESDZGM-FOCLMDBBSA-N |
| XLogP | 3.92 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(E)-1,1-bis(benzenesulfonyl)-1-fluoro-4-trimethylsilylbut-3-en-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-1,1-bis(benzenesulfonyl)-1-fluoro-4-trimethylsilylbut-3-en-2-yl] acetate?
The IUPAC name of [(E)-1,1-bis(benzenesulfonyl)-1-fluoro-4-trimethylsilylbut-3-en-2-yl] acetate (CID 102322738) is [(E)-1,1-bis(benzenesulfonyl)-1-fluoro-4-trimethylsilylbut-3-en-2-yl] acetate.
What is the SMILES notation for [(E)-1,1-bis(benzenesulfonyl)-1-fluoro-4-trimethylsilylbut-3-en-2-yl] acetate?
The canonical SMILES for [(E)-1,1-bis(benzenesulfonyl)-1-fluoro-4-trimethylsilylbut-3-en-2-yl] acetate is CC(=O)OC(/C=C/[Si](C)(C)C)C(F)(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1.
What is the InChIKey of [(E)-1,1-bis(benzenesulfonyl)-1-fluoro-4-trimethylsilylbut-3-en-2-yl] acetate?
The InChIKey is BWFLNHCVESDZGM-FOCLMDBBSA-N. The full InChI is InChI=1S/C21H25FO6S2Si/c1-17(23)28-20(15-16-31(2,3)4)21(22,29(24,25)18-11-7-5-8-12-18)30(26,27)19-13-9-6-10-14-19/h5-16,20H,1-4H3/b16-15+.
What are the key properties of [(E)-1,1-bis(benzenesulfonyl)-1-fluoro-4-trimethylsilylbut-3-en-2-yl] acetate?
[(E)-1,1-bis(benzenesulfonyl)-1-fluoro-4-trimethylsilylbut-3-en-2-yl] acetate has a molecular weight of 484.64 g/mol, XLogP of 3.92, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-1,1-bis(benzenesulfonyl)-1-fluoro-4-trimethylsilylbut-3-en-2-yl] acetate is sourced from PubChem (CID 102322738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).