C9H8N2O4S — CID 102323019
2-[(4S)-2,5-dioxo-1-thiophen-3-ylimidazolidin-4-yl]acetic acid (PubChem CID 102323019) has the molecular formula C9H8N2O4S and a molecular weight of 240.24 g/mol. Its IUPAC name is 2-[(4S)-2,5-dioxo-1-thiophen-3-ylimidazolidin-4-yl]acetic acid.
| Compound Name | 2-[(4S)-2,5-dioxo-1-thiophen-3-ylimidazolidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 102323019 |
| Molecular Formula | C9H8N2O4S |
| Molecular Weight | 240.24 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | 2-[(4S)-2,5-dioxo-1-thiophen-3-ylimidazolidin-4-yl]acetic acid |
| SMILES | O=C(O)C[C@@H]1NC(=O)N(c2ccsc2)C1=O |
| InChI | InChI=1S/C9H8N2O4S/c12-7(13)3-6-8(14)11(9(15)10-6)5-1-2-16-4-5/h1-2,4,6H,3H2,(H,10,15)(H,12,13)/t6-/m0/s1 |
| InChIKey | BNEWGYPSFUXAJJ-LURJTMIESA-N |
| XLogP | 0.65 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.24 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|