C23H24O2Si — CID 102323358
3-trimethylsilylprop-2-ynyl 2-benzyl-4-phenylbuta-2,3-dienoate (PubChem CID 102323358) has the molecular formula C23H24O2Si and a molecular weight of 360.53 g/mol. Its IUPAC name is 3-trimethylsilylprop-2-ynyl 2-benzyl-4-phenylbuta-2,3-dienoate.
| Compound Name | 3-trimethylsilylprop-2-ynyl 2-benzyl-4-phenylbuta-2,3-dienoate |
|---|---|
| PubChem CID | 102323358 |
| Molecular Formula | C23H24O2Si |
| Molecular Weight | 360.53 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 3-trimethylsilylprop-2-ynyl 2-benzyl-4-phenylbuta-2,3-dienoate |
| SMILES | C[Si](C)(C)C#CCOC(=O)C(=C=Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C23H24O2Si/c1-26(2,3)18-10-17-25-23(24)22(19-21-13-8-5-9-14-21)16-15-20-11-6-4-7-12-20/h4-9,11-15H,17,19H2,1-3H3 |
| InChIKey | CQMSGGFJODZPGP-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.53 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|