C28H30N2O2+2 — CID 102323467
tert-butyl-[12-[tert-butyl(oxo)azaniumyl]-4-pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9(14),10,12,15,17,19-nonaenyl]-oxoazanium (PubChem CID 102323467) has the molecular formula C28H30N2O2+2 and a molecular weight of 426.56 g/mol. Its IUPAC name is tert-butyl-[12-[tert-butyl(oxo)azaniumyl]-4-pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9(14),10,12,15,17,19-nonaenyl]-oxoazanium.
| Compound Name | tert-butyl-[12-[tert-butyl(oxo)azaniumyl]-4-pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9(14),10,12,15,17,19-nonaenyl]-oxoazanium |
|---|---|
| PubChem CID | 102323467 |
| Molecular Formula | C28H30N2O2+2 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | tert-butyl-[12-[tert-butyl(oxo)azaniumyl]-4-pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9(14),10,12,15,17,19-nonaenyl]-oxoazanium |
| SMILES | CC(C)(C)[N+](=O)c1ccc2c(c1)C1c3ccccc3C2c2ccc([N+](=O)C(C)(C)C)cc21 |
| InChI | InChI=1S/C28H30N2O2/c1-27(2,3)29(31)17-11-13-21-23(15-17)26-20-10-8-7-9-19(20)25(21)22-14-12-18(16-24(22)26)30(32)28(4,5)6/h7-16,25-26H,1-6H3/q+2 |
| InChIKey | MHBMQZHJFRPJEB-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|