C26H25ClFNO8S2 — CID 10232349
3-benzoyloxypropyl 9-(2-chloro-6-fluorophenyl)-7-methyl-1,1,4,4-tetraoxo-3,5,6,9-tetrahydro-2H-[1,4]dithiepino[6,5-b]pyridine-8-carboxylate (PubChem CID 10232349) has the molecular formula C26H25ClFNO8S2 and a molecular weight of 598.07 g/mol. Its IUPAC name is 3-benzoyloxypropyl 9-(2-chloro-6-fluorophenyl)-7-methyl-1,1,4,4-tetraoxo-3,5,6,9-tetrahydro-2H-[1,4]dithiepino[6,5-b]pyridine-8-carboxylate.
| Compound Name | 3-benzoyloxypropyl 9-(2-chloro-6-fluorophenyl)-7-methyl-1,1,4,4-tetraoxo-3,5,6,9-tetrahydro-2H-[1,4]dithiepino[6,5-b]pyridine-8-carboxylate |
|---|---|
| PubChem CID | 10232349 |
| Molecular Formula | C26H25ClFNO8S2 |
| Molecular Weight | 598.07 g/mol |
| Exact Mass | 597.07 |
| IUPAC Name | 3-benzoyloxypropyl 9-(2-chloro-6-fluorophenyl)-7-methyl-1,1,4,4-tetraoxo-3,5,6,9-tetrahydro-2H-[1,4]dithiepino[6,5-b]pyridine-8-carboxylate |
| SMILES | CC1=C(C(=O)OCCCOC(=O)c2ccccc2)C(c2c(F)cccc2Cl)C2=C(CS(=O)(=O)CCS2(=O)=O)N1 |
| InChI | InChI=1S/C26H25ClFNO8S2/c1-16-21(26(31)37-12-6-11-36-25(30)17-7-3-2-4-8-17)23(22-18(27)9-5-10-19(22)28)24-20(29-16)15-38(32,33)13-14-39(24,34)35/h2-5,7-10,23,29H,6,11-15H2,1H3 |
| InChIKey | YMZIHGPPFYWMRZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 132.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.07 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|