C21H42O2Si — CID 102323570
[(E)-4-tritert-butylsilylbut-3-enyl] 2,2-dimethylpropanoate (PubChem CID 102323570) has the molecular formula C21H42O2Si and a molecular weight of 354.65 g/mol. Its IUPAC name is [(E)-4-tritert-butylsilylbut-3-enyl] 2,2-dimethylpropanoate.
| Compound Name | [(E)-4-tritert-butylsilylbut-3-enyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 102323570 |
| Molecular Formula | C21H42O2Si |
| Molecular Weight | 354.65 g/mol |
| Exact Mass | 354.30 |
| IUPAC Name | [(E)-4-tritert-butylsilylbut-3-enyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCC/C=C/[Si](C(C)(C)C)(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C21H42O2Si/c1-18(2,3)17(22)23-15-13-14-16-24(19(4,5)6,20(7,8)9)21(10,11)12/h14,16H,13,15H2,1-12H3/b16-14+ |
| InChIKey | IZXLVSJCALNQON-JQIJEIRASA-N |
| XLogP | 6.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.65 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|