C34H38N4O4S — CID 10232368
(4S)-N-[(1S)-2,3-dihydro-1H-inden-1-yl]-3-[(2S,3S)-3-(2,3-dihydro-1H-indole-4-carbonylamino)-2-hydroxy-4-phenylbutanoyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxamide (PubChem CID 10232368) has the molecular formula C34H38N4O4S and a molecular weight of 598.77 g/mol. Its IUPAC name is (4S)-N-[(1S)-2,3-dihydro-1H-inden-1-yl]-3-[(2S,3S)-3-(2,3-dihydro-1H-indole-4-carbonylamino)-2-hydroxy-4-phenylbutanoyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxamide.
| Compound Name | (4S)-N-[(1S)-2,3-dihydro-1H-inden-1-yl]-3-[(2S,3S)-3-(2,3-dihydro-1H-indole-4-carbonylamino)-2-hydroxy-4-phenylbutanoyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 10232368 |
| Molecular Formula | C34H38N4O4S |
| Molecular Weight | 598.77 g/mol |
| Exact Mass | 598.26 |
| IUPAC Name | (4S)-N-[(1S)-2,3-dihydro-1H-inden-1-yl]-3-[(2S,3S)-3-(2,3-dihydro-1H-indole-4-carbonylamino)-2-hydroxy-4-phenylbutanoyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxamide |
| SMILES | CC1(C)SCN(C(=O)[C@@H](O)[C@H](Cc2ccccc2)NC(=O)c2cccc3c2CCN3)[C@H]1C(=O)N[C@H]1CCc2ccccc21 |
| InChI | InChI=1S/C34H38N4O4S/c1-34(2)30(32(41)36-27-16-15-22-11-6-7-12-23(22)27)38(20-43-34)33(42)29(39)28(19-21-9-4-3-5-10-21)37-31(40)25-13-8-14-26-24(25)17-18-35-26/h3-14,27-30,35,39H,15-20H2,1-2H3,(H,36,41)(H,37,40)/t27-,28-,29-,30-/m0/s1 |
| InChIKey | QLLCRWVFRRFEJV-KRCBVYEFSA-N |
| XLogP | 3.84 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.77 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |