C13H24OSi — CID 102323746
tert-butyl-dimethyl-[[(1R,5S)-5-methyl-3-bicyclo[3.1.0]hex-2-enyl]oxy]silane (PubChem CID 102323746) has the molecular formula C13H24OSi and a molecular weight of 224.42 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(1R,5S)-5-methyl-3-bicyclo[3.1.0]hex-2-enyl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(1R,5S)-5-methyl-3-bicyclo[3.1.0]hex-2-enyl]oxy]silane |
|---|---|
| PubChem CID | 102323746 |
| Molecular Formula | C13H24OSi |
| Molecular Weight | 224.42 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | tert-butyl-dimethyl-[[(1R,5S)-5-methyl-3-bicyclo[3.1.0]hex-2-enyl]oxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)OC1=C[C@H]2C[C@@]2(C)C1 |
| InChI | InChI=1S/C13H24OSi/c1-12(2,3)15(5,6)14-11-7-10-8-13(10,4)9-11/h7,10H,8-9H2,1-6H3/t10-,13-/m0/s1 |
| InChIKey | CQNVJMXGAFVKOA-GWCFXTLKSA-N |
| XLogP | 4.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.42 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|