C15H28OSi — CID 102323747
tert-butyl-dimethyl-[[(1R,5S)-5-propan-2-yl-3-bicyclo[3.1.0]hex-2-enyl]oxy]silane (PubChem CID 102323747) has the molecular formula C15H28OSi and a molecular weight of 252.47 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(1R,5S)-5-propan-2-yl-3-bicyclo[3.1.0]hex-2-enyl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(1R,5S)-5-propan-2-yl-3-bicyclo[3.1.0]hex-2-enyl]oxy]silane |
|---|---|
| PubChem CID | 102323747 |
| Molecular Formula | C15H28OSi |
| Molecular Weight | 252.47 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | tert-butyl-dimethyl-[[(1R,5S)-5-propan-2-yl-3-bicyclo[3.1.0]hex-2-enyl]oxy]silane |
| SMILES | CC(C)[C@]12CC(O[Si](C)(C)C(C)(C)C)=C[C@H]1C2 |
| InChI | InChI=1S/C15H28OSi/c1-11(2)15-9-12(15)8-13(10-15)16-17(6,7)14(3,4)5/h8,11-12H,9-10H2,1-7H3/t12-,15-/m0/s1 |
| InChIKey | WKPQYUQIATVXHQ-WFASDCNBSA-N |
| XLogP | 4.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.47 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|