About CID 1023239
CID 1023239 (PubChem CID 1023239) has the molecular formula C32H18BrFO5
and a molecular weight of 581.39 g/mol.
Molecular Properties
| Compound Name | CID 1023239 |
| PubChem CID | 1023239 |
| Molecular Formula | C32H18BrFO5 |
| Molecular Weight | 581.39 g/mol |
| Exact Mass | 580.03 |
| IUPAC Name | — |
| SMILES | O=C1c2ccccc2C(=O)C12O[C@@H](c1ccc(F)cc1)C1(C(=O)c3ccccc3C1=O)[C@@H]2c1ccc(Br)cc1 |
| InChI | InChI=1S/C32H18BrFO5/c33-19-13-9-17(10-14-19)25-31(26(35)21-5-1-2-6-22(21)27(31)36)30(18-11-15-20(34)16-12-18)39-32(25)28(37)23-7-3-4-8-24(23)29(32)38/h1-16,25,30H/t25-,30-/m0/s1 |
| InChIKey | GKIXGOUMZKRZJB-QCDSWUKFSA-N |
| XLogP | 6.33 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 581.39 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze CID 1023239 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 1023239?
The IUPAC name of CID 1023239 (CID 1023239) is not available.
What is the SMILES notation for CID 1023239?
The canonical SMILES for CID 1023239 is O=C1c2ccccc2C(=O)C12O[C@@H](c1ccc(F)cc1)C1(C(=O)c3ccccc3C1=O)[C@@H]2c1ccc(Br)cc1.
What is the InChIKey of CID 1023239?
The InChIKey is GKIXGOUMZKRZJB-QCDSWUKFSA-N. The full InChI is InChI=1S/C32H18BrFO5/c33-19-13-9-17(10-14-19)25-31(26(35)21-5-1-2-6-22(21)27(31)36)30(18-11-15-20(34)16-12-18)39-32(25)28(37)23-7-3-4-8-24(23)29(32)38/h1-16,25,30H/t25-,30-/m0/s1.
What are the key properties of CID 1023239?
CID 1023239 has a molecular weight of 581.39 g/mol, XLogP of 6.33, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 1023239 is sourced from PubChem (CID 1023239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).