C37H64O5SSi3 — CID 102323995
[(2R,3R,4S,5R,6S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(phenylmethoxymethyl)-6-phenylsulfanyloxan-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 102323995) has the molecular formula C37H64O5SSi3 and a molecular weight of 705.24 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(phenylmethoxymethyl)-6-phenylsulfanyloxan-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R,3R,4S,5R,6S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(phenylmethoxymethyl)-6-phenylsulfanyloxan-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 102323995 |
| Molecular Formula | C37H64O5SSi3 |
| Molecular Weight | 705.24 g/mol |
| Exact Mass | 704.38 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(phenylmethoxymethyl)-6-phenylsulfanyloxan-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](Sc2ccccc2)O[C@H](COCc2ccccc2)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C37H64O5SSi3/c1-35(2,3)44(10,11)40-31-30(27-38-26-28-22-18-16-19-23-28)39-34(43-29-24-20-17-21-25-29)33(42-46(14,15)37(7,8)9)32(31)41-45(12,13)36(4,5)6/h16-25,30-34H,26-27H2,1-15H3/t30-,31-,32+,33-,34+/m1/s1 |
| InChIKey | LEDIXNGVZKZSJG-RUOAZZEASA-N |
| XLogP | 10.89 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.24 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|